C18H29ClN2 — CID 106870391
1-[(2-chloro-4-methylphenyl)methyl]-2,5,5-triethylpiperazine (PubChem CID 106870391) has the molecular formula C18H29ClN2 and a molecular weight of 308.90 g/mol. Its IUPAC name is 1-[(2-chloro-4-methylphenyl)methyl]-2,5,5-triethylpiperazine.
| Compound Name | 1-[(2-chloro-4-methylphenyl)methyl]-2,5,5-triethylpiperazine |
|---|---|
| PubChem CID | 106870391 |
| Molecular Formula | C18H29ClN2 |
| Molecular Weight | 308.90 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1-[(2-chloro-4-methylphenyl)methyl]-2,5,5-triethylpiperazine |
| SMILES | CCC1CNC(CC)(CC)CN1Cc1ccc(C)cc1Cl |
| InChI | InChI=1S/C18H29ClN2/c1-5-16-11-20-18(6-2,7-3)13-21(16)12-15-9-8-14(4)10-17(15)19/h8-10,16,20H,5-7,11-13H2,1-4H3 |
| InChIKey | QJVBEDGARRKWKH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |