C16H24Cl2N2 — CID 64934480
1-(2,5-dichlorophenyl)-2,5,5-triethylpiperazine (PubChem CID 64934480) has the molecular formula C16H24Cl2N2 and a molecular weight of 315.29 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2,5,5-triethylpiperazine.
| Compound Name | 1-(2,5-dichlorophenyl)-2,5,5-triethylpiperazine |
|---|---|
| PubChem CID | 64934480 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2,5,5-triethylpiperazine |
| SMILES | CCC1CNC(CC)(CC)CN1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H24Cl2N2/c1-4-13-10-19-16(5-2,6-3)11-20(13)15-9-12(17)7-8-14(15)18/h7-9,13,19H,4-6,10-11H2,1-3H3 |
| InChIKey | HJRJFZNGTOFORY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |