C16H22Cl2N2 — CID 64934102
5-cyclopropyl-1-(2,4-dichlorophenyl)-2-ethyl-5-methylpiperazine (PubChem CID 64934102) has the molecular formula C16H22Cl2N2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2,4-dichlorophenyl)-2-ethyl-5-methylpiperazine.
| Compound Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-2-ethyl-5-methylpiperazine |
|---|---|
| PubChem CID | 64934102 |
| Molecular Formula | C16H22Cl2N2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-cyclopropyl-1-(2,4-dichlorophenyl)-2-ethyl-5-methylpiperazine |
| SMILES | CCC1CNC(C)(C2CC2)CN1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H22Cl2N2/c1-3-13-9-19-16(2,11-4-5-11)10-20(13)15-7-6-12(17)8-14(15)18/h6-8,11,13,19H,3-5,9-10H2,1-2H3 |
| InChIKey | FSGPBUQAFZVPAK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |