C15H22Cl2N2 — CID 64935058
1-(2,5-dichlorophenyl)-2,5-diethyl-5-methylpiperazine (PubChem CID 64935058) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2,5-diethyl-5-methylpiperazine.
| Compound Name | 1-(2,5-dichlorophenyl)-2,5-diethyl-5-methylpiperazine |
|---|---|
| PubChem CID | 64935058 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2,5-diethyl-5-methylpiperazine |
| SMILES | CCC1CNC(C)(CC)CN1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H22Cl2N2/c1-4-12-9-18-15(3,5-2)10-19(12)14-8-11(16)6-7-13(14)17/h6-8,12,18H,4-5,9-10H2,1-3H3 |
| InChIKey | YUSUQXFTTWRXAL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |