C13H24N4O — CID 114185177
3-[(2,5,5-triethylpiperazin-1-yl)methyl]-1,2,4-oxadiazole (PubChem CID 114185177) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-[(2,5,5-triethylpiperazin-1-yl)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[(2,5,5-triethylpiperazin-1-yl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 114185177 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 3-[(2,5,5-triethylpiperazin-1-yl)methyl]-1,2,4-oxadiazole |
| SMILES | CCC1CNC(CC)(CC)CN1Cc1ncon1 |
| InChI | InChI=1S/C13H24N4O/c1-4-11-7-15-13(5-2,6-3)9-17(11)8-12-14-10-18-16-12/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | PDBLESHNNORCLO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |