C12H14N2O3S — CID 112597914
1-(1-thiophen-2-ylbutyl)-1,3-diazinane-2,4,6-trione (PubChem CID 112597914) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-(1-thiophen-2-ylbutyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(1-thiophen-2-ylbutyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112597914 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-(1-thiophen-2-ylbutyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC(c1cccs1)N1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C12H14N2O3S/c1-2-4-8(9-5-3-6-18-9)14-11(16)7-10(15)13-12(14)17/h3,5-6,8H,2,4,7H2,1H3,(H,13,15,17) |
| InChIKey | LAPLKGFKZGXTTH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|