C10H21N3OS — CID 79408484
2-methyl-3-(1,4-thiazepan-4-yl)butanehydrazide (PubChem CID 79408484) has the molecular formula C10H21N3OS and a molecular weight of 231.36 g/mol. Its IUPAC name is 2-methyl-3-(1,4-thiazepan-4-yl)butanehydrazide.
| Compound Name | 2-methyl-3-(1,4-thiazepan-4-yl)butanehydrazide |
|---|---|
| PubChem CID | 79408484 |
| Molecular Formula | C10H21N3OS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-methyl-3-(1,4-thiazepan-4-yl)butanehydrazide |
| SMILES | CC(C(=O)NN)C(C)N1CCCSCC1 |
| InChI | InChI=1S/C10H21N3OS/c1-8(10(14)12-11)9(2)13-4-3-6-15-7-5-13/h8-9H,3-7,11H2,1-2H3,(H,12,14) |
| InChIKey | AJSDKKXTBFRAAR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|