C14H23N3O2 — CID 79410877
(3S,4R)-1-[(1-cyclohexylpyrazol-3-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 79410877) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is (3S,4R)-1-[(1-cyclohexylpyrazol-3-yl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-[(1-cyclohexylpyrazol-3-yl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410877 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (3S,4R)-1-[(1-cyclohexylpyrazol-3-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(Cc2ccn(C3CCCCC3)n2)C[C@@H]1O |
| InChI | InChI=1S/C14H23N3O2/c18-13-9-16(10-14(13)19)8-11-6-7-17(15-11)12-4-2-1-3-5-12/h6-7,12-14,18-19H,1-5,8-10H2/t13-,14+ |
| InChIKey | ZHNZFVSEHPOVEV-OKILXGFUSA-N |
| XLogP | 0.93 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |