C13H21N3O2 — CID 79410698
(3S,4R)-1-[(1-cyclopentylpyrazol-3-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 79410698) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is (3S,4R)-1-[(1-cyclopentylpyrazol-3-yl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-[(1-cyclopentylpyrazol-3-yl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410698 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (3S,4R)-1-[(1-cyclopentylpyrazol-3-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(Cc2ccn(C3CCCC3)n2)C[C@@H]1O |
| InChI | InChI=1S/C13H21N3O2/c17-12-8-15(9-13(12)18)7-10-5-6-16(14-10)11-3-1-2-4-11/h5-6,11-13,17-18H,1-4,7-9H2/t12-,13+ |
| InChIKey | FIXLNSACGZTHIE-BETUJISGSA-N |
| XLogP | 0.54 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |