C15H24N4S — CID 64801483
1-[(1-cyclopentylpyrazol-3-yl)methyl]piperidine-3-carbothioamide (PubChem CID 64801483) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-[(1-cyclopentylpyrazol-3-yl)methyl]piperidine-3-carbothioamide.
| Compound Name | 1-[(1-cyclopentylpyrazol-3-yl)methyl]piperidine-3-carbothioamide |
|---|---|
| PubChem CID | 64801483 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-[(1-cyclopentylpyrazol-3-yl)methyl]piperidine-3-carbothioamide |
| SMILES | NC(=S)C1CCCN(Cc2ccn(C3CCCC3)n2)C1 |
| InChI | InChI=1S/C15H24N4S/c16-15(20)12-4-3-8-18(10-12)11-13-7-9-19(17-13)14-5-1-2-6-14/h7,9,12,14H,1-6,8,10-11H2,(H2,16,20) |
| InChIKey | UDCOPEHVQHNVJV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|