C11H25NO — CID 79411447
5-(aminomethyl)-2,3-dimethyloctan-4-ol (PubChem CID 79411447) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 5-(aminomethyl)-2,3-dimethyloctan-4-ol.
| Compound Name | 5-(aminomethyl)-2,3-dimethyloctan-4-ol |
|---|---|
| PubChem CID | 79411447 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 5-(aminomethyl)-2,3-dimethyloctan-4-ol |
| SMILES | CCCC(CN)C(O)C(C)C(C)C |
| InChI | InChI=1S/C11H25NO/c1-5-6-10(7-12)11(13)9(4)8(2)3/h8-11,13H,5-7,12H2,1-4H3 |
| InChIKey | MAVBWWHOYXIUFO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |