C11H18N2S — CID 79413175
2-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 79413175) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 2-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | 2-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 79413175 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | CCCCc1nc2c(s1)C(N)CCC2 |
| InChI | InChI=1S/C11H18N2S/c1-2-3-7-10-13-9-6-4-5-8(12)11(9)14-10/h8H,2-7,12H2,1H3 |
| InChIKey | VCQIWFVVNPYXCL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |