About 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine
2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 84661798) has the molecular formula C7H9ClN2S
and a molecular weight of 188.68 g/mol. Its IUPAC name is 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
Analyze 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine?
The IUPAC name of 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (CID 84661798) is 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
What is the SMILES notation for 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine?
The canonical SMILES for 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine is NC1CCCc2nc(Cl)sc21.
What is the InChIKey of 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine?
The InChIKey is PIWVIUCHQABTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2S/c8-7-10-5-3-1-2-4(9)6(5)11-7/h4H,1-3,9H2.
What are the key properties of 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine?
2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine has a molecular weight of 188.68 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine is sourced from PubChem (CID 84661798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).