4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid

C12H12BrClO3 — CID 79415115

IUPAC4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(C(=O)O)C(C)C(=O)c1cc(Cl)ccc1Br
InChIInChI=1S/C12H12BrClO3/c1-6(7(2)12(16)17)11(15)9-5-8(14)3-4-10(9)13/h3-7H,1-2H3,(H,16,17)
InChIKeyZVPQUROXDZOKDS-UHFFFAOYSA-N
MW319.58 g/mol
LogP3.64
Rot. Bonds4

About 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid

4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 79415115) has the molecular formula C12H12BrClO3 and a molecular weight of 319.58 g/mol. Its IUPAC name is 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID79415115
Molecular FormulaC12H12BrClO3
Molecular Weight319.58 g/mol
Exact Mass317.97
IUPAC Name4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(C(=O)O)C(C)C(=O)c1cc(Cl)ccc1Br
InChIInChI=1S/C12H12BrClO3/c1-6(7(2)12(16)17)11(15)9-5-8(14)3-4-10(9)13/h3-7H,1-2H3,(H,16,17)
InChIKeyZVPQUROXDZOKDS-UHFFFAOYSA-N
XLogP3.64
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.58
LogP ≤ 53.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid (CID 79415115) is 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid is CC(C(=O)O)C(C)C(=O)c1cc(Cl)ccc1Br.
What is the InChIKey of 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is ZVPQUROXDZOKDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrClO3/c1-6(7(2)12(16)17)11(15)9-5-8(14)3-4-10(9)13/h3-7H,1-2H3,(H,16,17).
What are the key properties of 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid?
4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 319.58 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromo-5-chlorophenyl)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 79415115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).