C14H15Br2NO2S — CID 79415248
1-(2,5-dibromo-4-methoxyphenoxy)-1-thiophen-3-ylpropan-2-amine (PubChem CID 79415248) has the molecular formula C14H15Br2NO2S and a molecular weight of 421.15 g/mol. Its IUPAC name is 1-(2,5-dibromo-4-methoxyphenoxy)-1-thiophen-3-ylpropan-2-amine.
| Compound Name | 1-(2,5-dibromo-4-methoxyphenoxy)-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 79415248 |
| Molecular Formula | C14H15Br2NO2S |
| Molecular Weight | 421.15 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | 1-(2,5-dibromo-4-methoxyphenoxy)-1-thiophen-3-ylpropan-2-amine |
| SMILES | COc1cc(Br)c(OC(c2ccsc2)C(C)N)cc1Br |
| InChI | InChI=1S/C14H15Br2NO2S/c1-8(17)14(9-3-4-20-7-9)19-13-6-10(15)12(18-2)5-11(13)16/h3-8,14H,17H2,1-2H3 |
| InChIKey | DOLRBRPVOQKTNZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |