C12H12Br2O3 — CID 79415822
1-(4,7-dibromo-5-methoxy-1-benzofuran-2-yl)propan-1-ol (PubChem CID 79415822) has the molecular formula C12H12Br2O3 and a molecular weight of 364.03 g/mol. Its IUPAC name is 1-(4,7-dibromo-5-methoxy-1-benzofuran-2-yl)propan-1-ol.
| Compound Name | 1-(4,7-dibromo-5-methoxy-1-benzofuran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 79415822 |
| Molecular Formula | C12H12Br2O3 |
| Molecular Weight | 364.03 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | 1-(4,7-dibromo-5-methoxy-1-benzofuran-2-yl)propan-1-ol |
| SMILES | CCC(O)c1cc2c(Br)c(OC)cc(Br)c2o1 |
| InChI | InChI=1S/C12H12Br2O3/c1-3-8(15)9-4-6-11(14)10(16-2)5-7(13)12(6)17-9/h4-5,8,15H,3H2,1-2H3 |
| InChIKey | ULHUQPFLDHDORT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.03 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |