C13H27NO — CID 79416014
1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol (PubChem CID 79416014) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol.
| Compound Name | 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 79416014 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol |
| SMILES | CCCC(CN)C1(O)CCCC(C)C1C |
| InChI | InChI=1S/C13H27NO/c1-4-6-12(9-14)13(15)8-5-7-10(2)11(13)3/h10-12,15H,4-9,14H2,1-3H3 |
| InChIKey | BGFLWKSMSMKDEY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |