About 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol
1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol (PubChem CID 79416014) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol |
| PubChem CID | 79416014 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol |
| SMILES | CCCC(CN)C1(O)CCCC(C)C1C |
| InChI | InChI=1S/C13H27NO/c1-4-6-12(9-14)13(15)8-5-7-10(2)11(13)3/h10-12,15H,4-9,14H2,1-3H3 |
| InChIKey | BGFLWKSMSMKDEY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol?
The IUPAC name of 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol (CID 79416014) is 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol.
What is the SMILES notation for 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol?
The canonical SMILES for 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol is CCCC(CN)C1(O)CCCC(C)C1C.
What is the InChIKey of 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol?
The InChIKey is BGFLWKSMSMKDEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-4-6-12(9-14)13(15)8-5-7-10(2)11(13)3/h10-12,15H,4-9,14H2,1-3H3.
What are the key properties of 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol?
1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol has a molecular weight of 213.36 g/mol, XLogP of 2.55, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminopentan-2-yl)-2,3-dimethylcyclohexan-1-ol is sourced from PubChem (CID 79416014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).