C17H21N5S — CID 7941844
1-cyclopropyl-3-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea (PubChem CID 7941844) has the molecular formula C17H21N5S and a molecular weight of 327.46 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 7941844 |
| Molecular Formula | C17H21N5S |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-cyclopropyl-3-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
| SMILES | S=C(Nc1ccc(-c2nnc3n2CCCCC3)cc1)NC1CC1 |
| InChI | InChI=1S/C17H21N5S/c23-17(19-14-9-10-14)18-13-7-5-12(6-8-13)16-21-20-15-4-2-1-3-11-22(15)16/h5-8,14H,1-4,9-11H2,(H2,18,19,23) |
| InChIKey | BENCXYBSHFSSKY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|