C21H22ClN5S — CID 23966788
1-(3-chloro-4-methylphenyl)-3-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea (PubChem CID 23966788) has the molecular formula C21H22ClN5S and a molecular weight of 411.96 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 23966788 |
| Molecular Formula | C21H22ClN5S |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(-c3nnc4n3CCCCC4)cc2)cc1Cl |
| InChI | InChI=1S/C21H22ClN5S/c1-14-6-9-17(13-18(14)22)24-21(28)23-16-10-7-15(8-11-16)20-26-25-19-5-3-2-4-12-27(19)20/h6-11,13H,2-5,12H2,1H3,(H2,23,24,28) |
| InChIKey | CSMCCRVRTWROGM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|