C17H21NO3 — CID 79422338
5-(3-methylphenyl)-10-oxa-3-azaspiro[5.6]dodecane-2,4-dione (PubChem CID 79422338) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-(3-methylphenyl)-10-oxa-3-azaspiro[5.6]dodecane-2,4-dione.
| Compound Name | 5-(3-methylphenyl)-10-oxa-3-azaspiro[5.6]dodecane-2,4-dione |
|---|---|
| PubChem CID | 79422338 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-(3-methylphenyl)-10-oxa-3-azaspiro[5.6]dodecane-2,4-dione |
| SMILES | Cc1cccc(C2C(=O)NC(=O)CC23CCCOCC3)c1 |
| InChI | InChI=1S/C17H21NO3/c1-12-4-2-5-13(10-12)15-16(20)18-14(19)11-17(15)6-3-8-21-9-7-17/h2,4-5,10,15H,3,6-9,11H2,1H3,(H,18,19,20) |
| InChIKey | WAOHVCAGNRSKCI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|