C18H23NO2 — CID 80699261
3,3-dimethyl-10-(3-methylphenyl)-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 80699261) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3,3-dimethyl-10-(3-methylphenyl)-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 3,3-dimethyl-10-(3-methylphenyl)-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 80699261 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3,3-dimethyl-10-(3-methylphenyl)-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | Cc1cccc(C2C(=O)NC(=O)CC23CCC(C)(C)C3)c1 |
| InChI | InChI=1S/C18H23NO2/c1-12-5-4-6-13(9-12)15-16(21)19-14(20)10-18(15)8-7-17(2,3)11-18/h4-6,9,15H,7-8,10-11H2,1-3H3,(H,19,20,21) |
| InChIKey | BYXFSUXDRITADX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|