C15H20BrN3 — CID 79424338
5-[3-bromo-2-(3-methylphenyl)propyl]-1-propyl-1,2,4-triazole (PubChem CID 79424338) has the molecular formula C15H20BrN3 and a molecular weight of 322.25 g/mol. Its IUPAC name is 5-[3-bromo-2-(3-methylphenyl)propyl]-1-propyl-1,2,4-triazole.
| Compound Name | 5-[3-bromo-2-(3-methylphenyl)propyl]-1-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 79424338 |
| Molecular Formula | C15H20BrN3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[3-bromo-2-(3-methylphenyl)propyl]-1-propyl-1,2,4-triazole |
| SMILES | CCCn1ncnc1CC(CBr)c1cccc(C)c1 |
| InChI | InChI=1S/C15H20BrN3/c1-3-7-19-15(17-11-18-19)9-14(10-16)13-6-4-5-12(2)8-13/h4-6,8,11,14H,3,7,9-10H2,1-2H3 |
| InChIKey | DTOUAYXFQOWURI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|