C12H20O3 — CID 79426153
1-[(1-hydroxycyclohexyl)methyl]cyclobutane-1-carboxylic acid (PubChem CID 79426153) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-[(1-hydroxycyclohexyl)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(1-hydroxycyclohexyl)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 79426153 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1-[(1-hydroxycyclohexyl)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(CC2(O)CCCCC2)CCC1 |
| InChI | InChI=1S/C12H20O3/c13-10(14)11(5-4-6-11)9-12(15)7-2-1-3-8-12/h15H,1-9H2,(H,13,14) |
| InChIKey | BRBZSYYEOFCJJK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |