C17H30O3 — CID 79424914
4-butyl-1-[(1-hydroxycyclopentyl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 79424914) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 4-butyl-1-[(1-hydroxycyclopentyl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-butyl-1-[(1-hydroxycyclopentyl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79424914 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 4-butyl-1-[(1-hydroxycyclopentyl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCC1CCC(CC2(O)CCCC2)(C(=O)O)CC1 |
| InChI | InChI=1S/C17H30O3/c1-2-3-6-14-7-11-16(12-8-14,15(18)19)13-17(20)9-4-5-10-17/h14,20H,2-13H2,1H3,(H,18,19) |
| InChIKey | IGRSVMLHGLSMLD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |