C16H28O3 — CID 106930024
4-butyl-1-(cyclopropylmethoxymethyl)cyclohexane-1-carboxylic acid (PubChem CID 106930024) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-butyl-1-(cyclopropylmethoxymethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-butyl-1-(cyclopropylmethoxymethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106930024 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 4-butyl-1-(cyclopropylmethoxymethyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCC1CCC(COCC2CC2)(C(=O)O)CC1 |
| InChI | InChI=1S/C16H28O3/c1-2-3-4-13-7-9-16(10-8-13,15(17)18)12-19-11-14-5-6-14/h13-14H,2-12H2,1H3,(H,17,18) |
| InChIKey | IOAQCAZMSYQUGK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |