C17H32O2 — CID 63402944
4-butyl-1-(2-methylpentyl)cyclohexane-1-carboxylic acid (PubChem CID 63402944) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 4-butyl-1-(2-methylpentyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-butyl-1-(2-methylpentyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63402944 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 4-butyl-1-(2-methylpentyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCC1CCC(CC(C)CCC)(C(=O)O)CC1 |
| InChI | InChI=1S/C17H32O2/c1-4-6-8-15-9-11-17(12-10-15,16(18)19)13-14(3)7-5-2/h14-15H,4-13H2,1-3H3,(H,18,19) |
| InChIKey | FOWRHPDWWROWJY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |