C16H26O2 — CID 113374220
4-butyl-1-pent-4-ynylcyclohexane-1-carboxylic acid (PubChem CID 113374220) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-butyl-1-pent-4-ynylcyclohexane-1-carboxylic acid.
| Compound Name | 4-butyl-1-pent-4-ynylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 113374220 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-butyl-1-pent-4-ynylcyclohexane-1-carboxylic acid |
| SMILES | C#CCCCC1(C(=O)O)CCC(CCCC)CC1 |
| InChI | InChI=1S/C16H26O2/c1-3-5-7-11-16(15(17)18)12-9-14(10-13-16)8-6-4-2/h1,14H,4-13H2,2H3,(H,17,18) |
| InChIKey | MAJMOYZZHYYIKV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|