C15H26O2 — CID 79425782
1-but-3-en-2-yl-4-butylcyclohexane-1-carboxylic acid (PubChem CID 79425782) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-but-3-en-2-yl-4-butylcyclohexane-1-carboxylic acid.
| Compound Name | 1-but-3-en-2-yl-4-butylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79425782 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-but-3-en-2-yl-4-butylcyclohexane-1-carboxylic acid |
| SMILES | C=CC(C)C1(C(=O)O)CCC(CCCC)CC1 |
| InChI | InChI=1S/C15H26O2/c1-4-6-7-13-8-10-15(11-9-13,14(16)17)12(3)5-2/h5,12-13H,2,4,6-11H2,1,3H3,(H,16,17) |
| InChIKey | CPEOEPGYKAQBME-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|