C18H32O2 — CID 82929194
4-butyl-1-cycloheptylcyclohexane-1-carboxylic acid (PubChem CID 82929194) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 4-butyl-1-cycloheptylcyclohexane-1-carboxylic acid.
| Compound Name | 4-butyl-1-cycloheptylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 82929194 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 4-butyl-1-cycloheptylcyclohexane-1-carboxylic acid |
| SMILES | CCCCC1CCC(C(=O)O)(C2CCCCCC2)CC1 |
| InChI | InChI=1S/C18H32O2/c1-2-3-8-15-11-13-18(14-12-15,17(19)20)16-9-6-4-5-7-10-16/h15-16H,2-14H2,1H3,(H,19,20) |
| InChIKey | AFXHROIEFLOUPE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |