C15H26O2 — CID 79428277
1-cyclopentyl-4-propylcyclohexane-1-carboxylic acid (PubChem CID 79428277) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-cyclopentyl-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 1-cyclopentyl-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79428277 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-cyclopentyl-4-propylcyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(C(=O)O)(C2CCCC2)CC1 |
| InChI | InChI=1S/C15H26O2/c1-2-5-12-8-10-15(11-9-12,14(16)17)13-6-3-4-7-13/h12-13H,2-11H2,1H3,(H,16,17) |
| InChIKey | ZAZLPZYFJXTVDL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |