C13H12ClN3S — CID 79427479
N-(1H-benzimidazol-2-ylmethyl)-1-(4-chlorothiophen-2-yl)methanamine (PubChem CID 79427479) has the molecular formula C13H12ClN3S and a molecular weight of 277.78 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-1-(4-chlorothiophen-2-yl)methanamine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-1-(4-chlorothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 79427479 |
| Molecular Formula | C13H12ClN3S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-1-(4-chlorothiophen-2-yl)methanamine |
| SMILES | Clc1csc(CNCc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C13H12ClN3S/c14-9-5-10(18-8-9)6-15-7-13-16-11-3-1-2-4-12(11)17-13/h1-5,8,15H,6-7H2,(H,16,17) |
| InChIKey | NQUNMDQFSNULAB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |