C11H11BrClN3S — CID 79427772
5-bromo-2-(4-chlorothiophen-2-yl)-6-ethyl-N-methylpyrimidin-4-amine (PubChem CID 79427772) has the molecular formula C11H11BrClN3S and a molecular weight of 332.65 g/mol. Its IUPAC name is 5-bromo-2-(4-chlorothiophen-2-yl)-6-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(4-chlorothiophen-2-yl)-6-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79427772 |
| Molecular Formula | C11H11BrClN3S |
| Molecular Weight | 332.65 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 5-bromo-2-(4-chlorothiophen-2-yl)-6-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1nc(-c2cc(Cl)cs2)nc(NC)c1Br |
| InChI | InChI=1S/C11H11BrClN3S/c1-3-7-9(12)11(14-2)16-10(15-7)8-4-6(13)5-17-8/h4-5H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | WRWHTZPWPNFGDS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |