C19H22BrN — CID 79430904
3-(3-bromophenyl)-4-(2,5-dimethylphenyl)piperidine (PubChem CID 79430904) has the molecular formula C19H22BrN and a molecular weight of 344.30 g/mol. Its IUPAC name is 3-(3-bromophenyl)-4-(2,5-dimethylphenyl)piperidine.
| Compound Name | 3-(3-bromophenyl)-4-(2,5-dimethylphenyl)piperidine |
|---|---|
| PubChem CID | 79430904 |
| Molecular Formula | C19H22BrN |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-(3-bromophenyl)-4-(2,5-dimethylphenyl)piperidine |
| SMILES | Cc1ccc(C)c(C2CCNCC2c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C19H22BrN/c1-13-6-7-14(2)18(10-13)17-8-9-21-12-19(17)15-4-3-5-16(20)11-15/h3-7,10-11,17,19,21H,8-9,12H2,1-2H3 |
| InChIKey | LHHOVGNMGDKXGH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |