C17H16BrCl2N — CID 79430909
3-(3-bromophenyl)-4-(3,4-dichlorophenyl)piperidine (PubChem CID 79430909) has the molecular formula C17H16BrCl2N and a molecular weight of 385.13 g/mol. Its IUPAC name is 3-(3-bromophenyl)-4-(3,4-dichlorophenyl)piperidine.
| Compound Name | 3-(3-bromophenyl)-4-(3,4-dichlorophenyl)piperidine |
|---|---|
| PubChem CID | 79430909 |
| Molecular Formula | C17H16BrCl2N |
| Molecular Weight | 385.13 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 3-(3-bromophenyl)-4-(3,4-dichlorophenyl)piperidine |
| SMILES | Clc1ccc(C2CCNCC2c2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C17H16BrCl2N/c18-13-3-1-2-11(8-13)15-10-21-7-6-14(15)12-4-5-16(19)17(20)9-12/h1-5,8-9,14-15,21H,6-7,10H2 |
| InChIKey | SQOKFGKDGXDFAC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.13 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |