C17H16Cl2FN — CID 79440006
4-(3,4-dichlorophenyl)-3-(2-fluorophenyl)piperidine (PubChem CID 79440006) has the molecular formula C17H16Cl2FN and a molecular weight of 324.23 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3-(2-fluorophenyl)piperidine.
| Compound Name | 4-(3,4-dichlorophenyl)-3-(2-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 79440006 |
| Molecular Formula | C17H16Cl2FN |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3-(2-fluorophenyl)piperidine |
| SMILES | Fc1ccccc1C1CNCCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2FN/c18-15-6-5-11(9-16(15)19)12-7-8-21-10-14(12)13-3-1-2-4-17(13)20/h1-6,9,12,14,21H,7-8,10H2 |
| InChIKey | SVEHWHOMFFRHLJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |