C15H14Br2FNS — CID 102845494
4-(4,5-dibromothiophen-2-yl)-3-(2-fluorophenyl)piperidine (PubChem CID 102845494) has the molecular formula C15H14Br2FNS and a molecular weight of 419.16 g/mol. Its IUPAC name is 4-(4,5-dibromothiophen-2-yl)-3-(2-fluorophenyl)piperidine.
| Compound Name | 4-(4,5-dibromothiophen-2-yl)-3-(2-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 102845494 |
| Molecular Formula | C15H14Br2FNS |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 416.92 |
| IUPAC Name | 4-(4,5-dibromothiophen-2-yl)-3-(2-fluorophenyl)piperidine |
| SMILES | Fc1ccccc1C1CNCCC1c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H14Br2FNS/c16-12-7-14(20-15(12)17)10-5-6-19-8-11(10)9-3-1-2-4-13(9)18/h1-4,7,10-11,19H,5-6,8H2 |
| InChIKey | IGFLXIHHJCXTRB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |