C18H19ClFN — CID 106819231
4-(3-chloro-4-methylphenyl)-3-(2-fluorophenyl)piperidine (PubChem CID 106819231) has the molecular formula C18H19ClFN and a molecular weight of 303.81 g/mol. Its IUPAC name is 4-(3-chloro-4-methylphenyl)-3-(2-fluorophenyl)piperidine.
| Compound Name | 4-(3-chloro-4-methylphenyl)-3-(2-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 106819231 |
| Molecular Formula | C18H19ClFN |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-(3-chloro-4-methylphenyl)-3-(2-fluorophenyl)piperidine |
| SMILES | Cc1ccc(C2CCNCC2c2ccccc2F)cc1Cl |
| InChI | InChI=1S/C18H19ClFN/c1-12-6-7-13(10-17(12)19)14-8-9-21-11-16(14)15-4-2-3-5-18(15)20/h2-7,10,14,16,21H,8-9,11H2,1H3 |
| InChIKey | XVEDKFZVGHXASX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |