C16H20FN3 — CID 79596341
4-(1,5-dimethylpyrazol-4-yl)-3-(2-fluorophenyl)piperidine (PubChem CID 79596341) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is 4-(1,5-dimethylpyrazol-4-yl)-3-(2-fluorophenyl)piperidine.
| Compound Name | 4-(1,5-dimethylpyrazol-4-yl)-3-(2-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 79596341 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 4-(1,5-dimethylpyrazol-4-yl)-3-(2-fluorophenyl)piperidine |
| SMILES | Cc1c(C2CCNCC2c2ccccc2F)cnn1C |
| InChI | InChI=1S/C16H20FN3/c1-11-14(10-19-20(11)2)12-7-8-18-9-15(12)13-5-3-4-6-16(13)17/h3-6,10,12,15,18H,7-9H2,1-2H3 |
| InChIKey | FGJWLUPRSWVFEE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |