C14H8BrFN2O3 — CID 79431371
2-(5-bromofuran-2-yl)-5-(4-fluorophenyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 79431371) has the molecular formula C14H8BrFN2O3 and a molecular weight of 351.13 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-5-(4-fluorophenyl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(5-bromofuran-2-yl)-5-(4-fluorophenyl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79431371 |
| Molecular Formula | C14H8BrFN2O3 |
| Molecular Weight | 351.13 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-5-(4-fluorophenyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccc(Br)o2)nc(O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H8BrFN2O3/c15-10-6-5-9(21-10)12-17-13(19)11(14(20)18-12)7-1-3-8(16)4-2-7/h1-6H,(H2,17,18,19,20) |
| InChIKey | AEPXOVHLCIIGLB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.13 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |