About 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane
5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane (PubChem CID 79434074) has the molecular formula C18H26ClN
and a molecular weight of 291.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane |
| PubChem CID | 79434074 |
| Molecular Formula | C18H26ClN |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane |
| SMILES | CC1CCC(C)C2(CCNCC2c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H26ClN/c1-13-3-4-14(2)18(11-13)9-10-20-12-17(18)15-5-7-16(19)8-6-15/h5-8,13-14,17,20H,3-4,9-12H2,1-2H3 |
| InChIKey | IMCLTEPLKZAMDX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane?
The IUPAC name of 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane (CID 79434074) is 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane.
What is the SMILES notation for 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane?
The canonical SMILES for 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane is CC1CCC(C)C2(CCNCC2c2ccc(Cl)cc2)C1.
What is the InChIKey of 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane?
The InChIKey is IMCLTEPLKZAMDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26ClN/c1-13-3-4-14(2)18(11-13)9-10-20-12-17(18)15-5-7-16(19)8-6-15/h5-8,13-14,17,20H,3-4,9-12H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane?
5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane has a molecular weight of 291.87 g/mol, XLogP of 4.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-8,11-dimethyl-3-azaspiro[5.5]undecane is sourced from PubChem (CID 79434074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).