C17H21NS — CID 79437348
N-[2-(4-methylphenyl)-3-thiophen-2-ylpropyl]cyclopropanamine (PubChem CID 79437348) has the molecular formula C17H21NS and a molecular weight of 271.43 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)-3-thiophen-2-ylpropyl]cyclopropanamine.
| Compound Name | N-[2-(4-methylphenyl)-3-thiophen-2-ylpropyl]cyclopropanamine |
|---|---|
| PubChem CID | 79437348 |
| Molecular Formula | C17H21NS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[2-(4-methylphenyl)-3-thiophen-2-ylpropyl]cyclopropanamine |
| SMILES | Cc1ccc(C(CNC2CC2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C17H21NS/c1-13-4-6-14(7-5-13)15(12-18-16-8-9-16)11-17-3-2-10-19-17/h2-7,10,15-16,18H,8-9,11-12H2,1H3 |
| InChIKey | ORYPSOZITGXEAY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |