About 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine
5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine (PubChem CID 79438613) has the molecular formula C12H10BrCl2N3
and a molecular weight of 347.04 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine |
| PubChem CID | 79438613 |
| Molecular Formula | C12H10BrCl2N3 |
| Molecular Weight | 347.04 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine |
| SMILES | CN(C)c1nc(Cl)c(-c2ccc(Br)cc2)c(Cl)n1 |
| InChI | InChI=1S/C12H10BrCl2N3/c1-18(2)12-16-10(14)9(11(15)17-12)7-3-5-8(13)6-4-7/h3-6H,1-2H3 |
| InChIKey | GRWAQQOASYSSAI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine?
The IUPAC name of 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine (CID 79438613) is 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine.
What is the SMILES notation for 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine?
The canonical SMILES for 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine is CN(C)c1nc(Cl)c(-c2ccc(Br)cc2)c(Cl)n1.
What is the InChIKey of 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine?
The InChIKey is GRWAQQOASYSSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrCl2N3/c1-18(2)12-16-10(14)9(11(15)17-12)7-3-5-8(13)6-4-7/h3-6H,1-2H3.
What are the key properties of 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine?
5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine has a molecular weight of 347.04 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine is sourced from PubChem (CID 79438613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).