C12H10BrCl2N3 — CID 79438613
5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine (PubChem CID 79438613) has the molecular formula C12H10BrCl2N3 and a molecular weight of 347.04 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 79438613 |
| Molecular Formula | C12H10BrCl2N3 |
| Molecular Weight | 347.04 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 5-(4-bromophenyl)-4,6-dichloro-N,N-dimethylpyrimidin-2-amine |
| SMILES | CN(C)c1nc(Cl)c(-c2ccc(Br)cc2)c(Cl)n1 |
| InChI | InChI=1S/C12H10BrCl2N3/c1-18(2)12-16-10(14)9(11(15)17-12)7-3-5-8(13)6-4-7/h3-6H,1-2H3 |
| InChIKey | GRWAQQOASYSSAI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |