About 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane
5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane (PubChem CID 79438736) has the molecular formula C19H28BrN
and a molecular weight of 350.34 g/mol. Its IUPAC name is 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane |
| PubChem CID | 79438736 |
| Molecular Formula | C19H28BrN |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane |
| SMILES | CC1CC(C)(C)CC2(CCNCC2c2ccccc2Br)C1 |
| InChI | InChI=1S/C19H28BrN/c1-14-10-18(2,3)13-19(11-14)8-9-21-12-16(19)15-6-4-5-7-17(15)20/h4-7,14,16,21H,8-13H2,1-3H3 |
| InChIKey | OYBSHYGDADGQIW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane?
The IUPAC name of 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane (CID 79438736) is 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane.
What is the SMILES notation for 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane?
The canonical SMILES for 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane is CC1CC(C)(C)CC2(CCNCC2c2ccccc2Br)C1.
What is the InChIKey of 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane?
The InChIKey is OYBSHYGDADGQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28BrN/c1-14-10-18(2,3)13-19(11-14)8-9-21-12-16(19)15-6-4-5-7-17(15)20/h4-7,14,16,21H,8-13H2,1-3H3.
What are the key properties of 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane?
5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane has a molecular weight of 350.34 g/mol, XLogP of 5.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromophenyl)-8,10,10-trimethyl-3-azaspiro[5.5]undecane is sourced from PubChem (CID 79438736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).