C19H28BrN — CID 79439161
5-(2-bromophenyl)-9-ethyl-3-azaspiro[5.6]dodecane (PubChem CID 79439161) has the molecular formula C19H28BrN and a molecular weight of 350.34 g/mol. Its IUPAC name is 5-(2-bromophenyl)-9-ethyl-3-azaspiro[5.6]dodecane.
| Compound Name | 5-(2-bromophenyl)-9-ethyl-3-azaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 79439161 |
| Molecular Formula | C19H28BrN |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 5-(2-bromophenyl)-9-ethyl-3-azaspiro[5.6]dodecane |
| SMILES | CCC1CCCC2(CCNCC2c2ccccc2Br)CC1 |
| InChI | InChI=1S/C19H28BrN/c1-2-15-6-5-10-19(11-9-15)12-13-21-14-17(19)16-7-3-4-8-18(16)20/h3-4,7-8,15,17,21H,2,5-6,9-14H2,1H3 |
| InChIKey | YETGJPASNIJDGX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |