C18H28N2 — CID 79441909
3-ethyl-11-(3-methylphenyl)-3,9-diazaspiro[5.5]undecane (PubChem CID 79441909) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 3-ethyl-11-(3-methylphenyl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-ethyl-11-(3-methylphenyl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79441909 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 3-ethyl-11-(3-methylphenyl)-3,9-diazaspiro[5.5]undecane |
| SMILES | CCN1CCC2(CCNCC2c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C18H28N2/c1-3-20-11-8-18(9-12-20)7-10-19-14-17(18)16-6-4-5-15(2)13-16/h4-6,13,17,19H,3,7-12,14H2,1-2H3 |
| InChIKey | KGTLFIDSHWVNEL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |