About (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine
(4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine (PubChem CID 125450470) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine.
Molecular Properties
| Compound Name | (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine |
| PubChem CID | 125450470 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine |
| SMILES | CCC1(CC)CNC[C@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C15H23N/c1-4-15(5-2)11-16-10-14(15)13-8-6-7-12(3)9-13/h6-9,14,16H,4-5,10-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | MTTJRNDOIOGCRJ-AWEZNQCLSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine?
The IUPAC name of (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine (CID 125450470) is (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine.
What is the SMILES notation for (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine?
The canonical SMILES for (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine is CCC1(CC)CNC[C@H]1c1cccc(C)c1.
What is the InChIKey of (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine?
The InChIKey is MTTJRNDOIOGCRJ-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H23N/c1-4-15(5-2)11-16-10-14(15)13-8-6-7-12(3)9-13/h6-9,14,16H,4-5,10-11H2,1-3H3/t14-/m0/s1.
What are the key properties of (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine?
(4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine has a molecular weight of 217.36 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,3-diethyl-4-(3-methylphenyl)pyrrolidine is sourced from PubChem (CID 125450470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).