C15H20O — CID 81416308
2,2-diethyl-3-(3-methylphenyl)cyclobutan-1-one (PubChem CID 81416308) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 2,2-diethyl-3-(3-methylphenyl)cyclobutan-1-one.
| Compound Name | 2,2-diethyl-3-(3-methylphenyl)cyclobutan-1-one |
|---|---|
| PubChem CID | 81416308 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,2-diethyl-3-(3-methylphenyl)cyclobutan-1-one |
| SMILES | CCC1(CC)C(=O)CC1c1cccc(C)c1 |
| InChI | InChI=1S/C15H20O/c1-4-15(5-2)13(10-14(15)16)12-8-6-7-11(3)9-12/h6-9,13H,4-5,10H2,1-3H3 |
| InChIKey | HPGTUOOOWUNKRG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |