C15H31N — CID 79445973
N,2-dimethyl-1-(4-propylcyclohexyl)butan-1-amine (PubChem CID 79445973) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is N,2-dimethyl-1-(4-propylcyclohexyl)butan-1-amine.
| Compound Name | N,2-dimethyl-1-(4-propylcyclohexyl)butan-1-amine |
|---|---|
| PubChem CID | 79445973 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N,2-dimethyl-1-(4-propylcyclohexyl)butan-1-amine |
| SMILES | CCCC1CCC(C(NC)C(C)CC)CC1 |
| InChI | InChI=1S/C15H31N/c1-5-7-13-8-10-14(11-9-13)15(16-4)12(3)6-2/h12-16H,5-11H2,1-4H3 |
| InChIKey | FZTSNVVFDLMLMJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |