C15H31N — CID 79446345
N,2-dimethyl-1-(4-propan-2-ylcyclohexyl)butan-1-amine (PubChem CID 79446345) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is N,2-dimethyl-1-(4-propan-2-ylcyclohexyl)butan-1-amine.
| Compound Name | N,2-dimethyl-1-(4-propan-2-ylcyclohexyl)butan-1-amine |
|---|---|
| PubChem CID | 79446345 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N,2-dimethyl-1-(4-propan-2-ylcyclohexyl)butan-1-amine |
| SMILES | CCC(C)C(NC)C1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C15H31N/c1-6-12(4)15(16-5)14-9-7-13(8-10-14)11(2)3/h11-16H,6-10H2,1-5H3 |
| InChIKey | PKRWPNHJDVLRKR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |