C10H21NO — CID 116720061
1-cyclopropyl-2-methoxy-N,3-dimethylbutan-1-amine (PubChem CID 116720061) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 1-cyclopropyl-2-methoxy-N,3-dimethylbutan-1-amine.
| Compound Name | 1-cyclopropyl-2-methoxy-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 116720061 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 1-cyclopropyl-2-methoxy-N,3-dimethylbutan-1-amine |
| SMILES | CNC(C1CC1)C(OC)C(C)C |
| InChI | InChI=1S/C10H21NO/c1-7(2)10(12-4)9(11-3)8-5-6-8/h7-11H,5-6H2,1-4H3 |
| InChIKey | WVPOMEOMNCZUSD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |